C11H17NO9 — CID 74942744
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-nitrooxybutyl carbonate (PubChem CID 74942744) has the molecular formula C11H17NO9 and a molecular weight of 307.26 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-nitrooxybutyl carbonate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-nitrooxybutyl carbonate |
|---|---|
| PubChem CID | 74942744 |
| Molecular Formula | C11H17NO9 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-nitrooxybutyl carbonate |
| SMILES | O=C(OCCCCO[N+](=O)[O-])OC1COC2C(O)COC12 |
| InChI | InChI=1S/C11H17NO9/c13-7-5-18-10-8(6-19-9(7)10)21-11(14)17-3-1-2-4-20-12(15)16/h7-10,13H,1-6H2 |
| InChIKey | MBIJCOBRADKZTH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|