C11H17IO4 — CID 11121347
[(3R,3aR,6S,6aS)-6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2,2-dimethylpropanoate (PubChem CID 11121347) has the molecular formula C11H17IO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,3aR,6S,6aS)-6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11121347 |
| Molecular Formula | C11H17IO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2I |
| InChI | InChI=1S/C11H17IO4/c1-11(2,3)10(13)16-7-5-15-8-6(12)4-14-9(7)8/h6-9H,4-5H2,1-3H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | SSEIBQWFDDKKQH-JQCXWYLXSA-N |
| XLogP | 1.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|