C9H14O2 — CID 168912947
acetylene;6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 168912947) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is acetylene;6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | acetylene;6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 168912947 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | acetylene;6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C#C.CC1COC2CCOC12 |
| InChI | InChI=1S/C7H12O2.C2H2/c1-5-4-9-6-2-3-8-7(5)6;1-2/h5-7H,2-4H2,1H3;1-2H |
| InChIKey | RXRIQSUDIXHBPJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|