C21H43NO2 — CID 143528563
ethane;(1,1,2,2,5,5,7,7-octamethyl-6-azaspiro[2.5]octan-6-yl) acetate (PubChem CID 143528563) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is ethane;(1,1,2,2,5,5,7,7-octamethyl-6-azaspiro[2.5]octan-6-yl) acetate.
| Compound Name | ethane;(1,1,2,2,5,5,7,7-octamethyl-6-azaspiro[2.5]octan-6-yl) acetate |
|---|---|
| PubChem CID | 143528563 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | ethane;(1,1,2,2,5,5,7,7-octamethyl-6-azaspiro[2.5]octan-6-yl) acetate |
| SMILES | CC.CC.CC(=O)ON1C(C)(C)CC2(CC1(C)C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H31NO2.2C2H6/c1-12(19)20-18-13(2,3)10-17(11-14(18,4)5)15(6,7)16(17,8)9;2*1-2/h10-11H2,1-9H3;2*1-2H3 |
| InChIKey | YKBRCVGTYDHTQX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |