(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate

C10H19NO3 — CID 22150807

IUPAC(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate
SMILESCC1(C)CCCC(C)(C)N1OC(=O)O
InChIInChI=1S/C10H19NO3/c1-9(2)6-5-7-10(3,4)11(9)14-8(12)13/h5-7H2,1-4H3,(H,12,13)
InChIKeyKZTOWUVMZYFOGE-UHFFFAOYSA-N
MW201.27 g/mol
LogP2.64
Rot. Bonds1

About (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate

(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate (PubChem CID 22150807) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate.

Molecular Properties

Compound Name(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate
PubChem CID22150807
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate
SMILESCC1(C)CCCC(C)(C)N1OC(=O)O
InChIInChI=1S/C10H19NO3/c1-9(2)6-5-7-10(3,4)11(9)14-8(12)13/h5-7H2,1-4H3,(H,12,13)
InChIKeyKZTOWUVMZYFOGE-UHFFFAOYSA-N
XLogP2.64
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 52.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate?
The IUPAC name of (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate (CID 22150807) is (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate.
What is the SMILES notation for (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate?
The canonical SMILES for (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate is CC1(C)CCCC(C)(C)N1OC(=O)O.
What is the InChIKey of (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate?
The InChIKey is KZTOWUVMZYFOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2)6-5-7-10(3,4)11(9)14-8(12)13/h5-7H2,1-4H3,(H,12,13).
What are the key properties of (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate?
(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate has a molecular weight of 201.27 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen carbonate is sourced from PubChem (CID 22150807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).