C23H42N2O4 — CID 67842348
5-oxo-4-(2,2,6,6-tetramethylpiperidin-1-yl)-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanoic acid (PubChem CID 67842348) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is 5-oxo-4-(2,2,6,6-tetramethylpiperidin-1-yl)-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanoic acid.
| Compound Name | 5-oxo-4-(2,2,6,6-tetramethylpiperidin-1-yl)-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanoic acid |
|---|---|
| PubChem CID | 67842348 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 5-oxo-4-(2,2,6,6-tetramethylpiperidin-1-yl)-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanoic acid |
| SMILES | CC1(C)CCCC(C)(C)N1OC(=O)C(CCC(=O)O)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C23H42N2O4/c1-20(2)13-9-14-21(3,4)24(20)17(11-12-18(26)27)19(28)29-25-22(5,6)15-10-16-23(25,7)8/h17H,9-16H2,1-8H3,(H,26,27) |
| InChIKey | PYYCUZLWGOJDGP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |