C18H36N2O2 — CID 166023714
(2,2,6,6-tetramethylpiperidin-1-yl) N-(2-ethylhexyl)carbamate (PubChem CID 166023714) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) N-(2-ethylhexyl)carbamate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) N-(2-ethylhexyl)carbamate |
|---|---|
| PubChem CID | 166023714 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) N-(2-ethylhexyl)carbamate |
| SMILES | CCCCC(CC)CNC(=O)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-7-9-11-15(8-2)14-19-16(21)22-20-17(3,4)12-10-13-18(20,5)6/h15H,7-14H2,1-6H3,(H,19,21) |
| InChIKey | AWAKBDLKHHONGI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |