C15H22NO2 — CID 102305745
CID 102305745 (PubChem CID 102305745) has the molecular formula C15H22NO2 and a molecular weight of 248.35 g/mol.
| Compound Name | CID 102305745 |
|---|---|
| PubChem CID | 102305745 |
| Molecular Formula | C15H22NO2 |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | — |
| SMILES | CC1(C)CCCC(C)(C)N1OC(=O)C1=CC=C[CH]1 |
| InChI | InChI=1S/C15H22NO2/c1-14(2)10-7-11-15(3,4)16(14)18-13(17)12-8-5-6-9-12/h5-6,8-9H,7,10-11H2,1-4H3 |
| InChIKey | OXMWGEFODYDRLO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |