C13H26N2O2 — CID 87238095
2,2,6,6-tetramethyl-1-pyrrolidin-1-ylperoxypiperidine (PubChem CID 87238095) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-pyrrolidin-1-ylperoxypiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-pyrrolidin-1-ylperoxypiperidine |
|---|---|
| PubChem CID | 87238095 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-pyrrolidin-1-ylperoxypiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1OON1CCCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2)8-7-9-13(3,4)15(12)17-16-14-10-5-6-11-14/h5-11H2,1-4H3 |
| InChIKey | MAMLYCDOAABXIY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|