C11H24NO4P — CID 100962421
dimethyl (2,2,6,6-tetramethylpiperidin-1-yl) phosphate (PubChem CID 100962421) has the molecular formula C11H24NO4P and a molecular weight of 265.29 g/mol. Its IUPAC name is dimethyl (2,2,6,6-tetramethylpiperidin-1-yl) phosphate.
| Compound Name | dimethyl (2,2,6,6-tetramethylpiperidin-1-yl) phosphate |
|---|---|
| PubChem CID | 100962421 |
| Molecular Formula | C11H24NO4P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | dimethyl (2,2,6,6-tetramethylpiperidin-1-yl) phosphate |
| SMILES | COP(=O)(OC)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C11H24NO4P/c1-10(2)8-7-9-11(3,4)12(10)16-17(13,14-5)15-6/h7-9H2,1-6H3 |
| InChIKey | VZMSVHCLUHLOBN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|