C16H30N2O4 — CID 102251767
(2,2,6,6-tetramethylpiperidin-1-yl) 5-[methoxy(methyl)amino]-5-oxopentanoate (PubChem CID 102251767) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) 5-[methoxy(methyl)amino]-5-oxopentanoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) 5-[methoxy(methyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 102251767 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) 5-[methoxy(methyl)amino]-5-oxopentanoate |
| SMILES | CON(C)C(=O)CCCC(=O)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-15(2)11-8-12-16(3,4)18(15)22-14(20)10-7-9-13(19)17(5)21-6/h7-12H2,1-6H3 |
| InChIKey | NTHXWODUROBKFY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|