C16H24NO9- — CID 11964456
bis(acetyloxymethyl) (3R,4R)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3,4-dicarboxylate (PubChem CID 11964456) has the molecular formula C16H24NO9- and a molecular weight of 374.37 g/mol. Its IUPAC name is bis(acetyloxymethyl) (3R,4R)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3,4-dicarboxylate.
| Compound Name | bis(acetyloxymethyl) (3R,4R)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11964456 |
| Molecular Formula | C16H24NO9- |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | bis(acetyloxymethyl) (3R,4R)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3,4-dicarboxylate |
| SMILES | CC(=O)OCOC(=O)[C@@H]1[C@@H](C(=O)OCOC(C)=O)C(C)(C)N([O-])C1(C)C |
| InChI | InChI=1S/C16H24NO9/c1-9(18)23-7-25-13(20)11-12(14(21)26-8-24-10(2)19)16(5,6)17(22)15(11,3)4/h11-12H,7-8H2,1-6H3/q-1/t11-,12-/m0/s1 |
| InChIKey | PYBNPRKTBHFMJE-RYUDHWBXSA-N |
| XLogP | 0.72 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|