C13H21N3O7 — CID 59178167
[(1R,2S)-2-nitrooxy-4-[(2R)-2-propan-2-ylpyrrolidine-1-carbonyl]cyclopentyl] nitrate (PubChem CID 59178167) has the molecular formula C13H21N3O7 and a molecular weight of 331.33 g/mol. Its IUPAC name is [(1R,2S)-2-nitrooxy-4-[(2R)-2-propan-2-ylpyrrolidine-1-carbonyl]cyclopentyl] nitrate.
| Compound Name | [(1R,2S)-2-nitrooxy-4-[(2R)-2-propan-2-ylpyrrolidine-1-carbonyl]cyclopentyl] nitrate |
|---|---|
| PubChem CID | 59178167 |
| Molecular Formula | C13H21N3O7 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(1R,2S)-2-nitrooxy-4-[(2R)-2-propan-2-ylpyrrolidine-1-carbonyl]cyclopentyl] nitrate |
| SMILES | CC(C)[C@H]1CCCN1C(=O)C1C[C@H](O[N+](=O)[O-])[C@H](O[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H21N3O7/c1-8(2)10-4-3-5-14(10)13(17)9-6-11(22-15(18)19)12(7-9)23-16(20)21/h8-12H,3-7H2,1-2H3/t9?,10-,11-,12+/m1/s1 |
| InChIKey | QIYGLWPHBPSOOR-RDFFEMEHSA-N |
| XLogP | 1.20 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|