C16H22N2O3 — CID 59062464
(4,5-dimethyl-2-nitrophenyl)-[(2S)-2-propan-2-ylpyrrolidin-1-yl]methanone (PubChem CID 59062464) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (4,5-dimethyl-2-nitrophenyl)-[(2S)-2-propan-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (4,5-dimethyl-2-nitrophenyl)-[(2S)-2-propan-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 59062464 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (4,5-dimethyl-2-nitrophenyl)-[(2S)-2-propan-2-ylpyrrolidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@H]2C(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)14-6-5-7-17(14)16(19)13-8-11(3)12(4)9-15(13)18(20)21/h8-10,14H,5-7H2,1-4H3/t14-/m0/s1 |
| InChIKey | KCGDIAKWANKHIR-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|