C16H20N2O5 — CID 119185456
3-nitro-5-(2-propan-2-ylpiperidine-1-carbonyl)benzoic acid (PubChem CID 119185456) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-nitro-5-(2-propan-2-ylpiperidine-1-carbonyl)benzoic acid.
| Compound Name | 3-nitro-5-(2-propan-2-ylpiperidine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 119185456 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-nitro-5-(2-propan-2-ylpiperidine-1-carbonyl)benzoic acid |
| SMILES | CC(C)C1CCCCN1C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N2O5/c1-10(2)14-5-3-4-6-17(14)15(19)11-7-12(16(20)21)9-13(8-11)18(22)23/h7-10,14H,3-6H2,1-2H3,(H,20,21) |
| InChIKey | DVRWTBIOSBXAGE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|