C12H10N3O7- — CID 78595854
1-(3,5-dinitrobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 78595854) has the molecular formula C12H10N3O7- and a molecular weight of 308.23 g/mol. Its IUPAC name is 1-(3,5-dinitrobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | 1-(3,5-dinitrobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 78595854 |
| Molecular Formula | C12H10N3O7- |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-(3,5-dinitrobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])C1CCCN1C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11N3O7/c16-11(13-3-1-2-10(13)12(17)18)7-4-8(14(19)20)6-9(5-7)15(21)22/h4-6,10H,1-3H2,(H,17,18)/p-1 |
| InChIKey | ILUIVNFRFIAWLJ-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|