3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid

C15H18N2O5 — CID 119179176

IUPAC3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid
SMILESCC1CCCC(C)N1C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1
InChIInChI=1S/C15H18N2O5/c1-9-4-3-5-10(2)16(9)14(18)11-6-12(15(19)20)8-13(7-11)17(21)22/h6-10H,3-5H2,1-2H3,(H,19,20)
InChIKeyOLIKUEPTLOIGEJ-UHFFFAOYSA-N
MW306.32 g/mol
LogP2.70
Rot. Bonds3

About 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid

3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid (PubChem CID 119179176) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid.

Molecular Properties

Compound Name3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid
PubChem CID119179176
Molecular FormulaC15H18N2O5
Molecular Weight306.32 g/mol
Exact Mass306.12
IUPAC Name3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid
SMILESCC1CCCC(C)N1C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1
InChIInChI=1S/C15H18N2O5/c1-9-4-3-5-10(2)16(9)14(18)11-6-12(15(19)20)8-13(7-11)17(21)22/h6-10H,3-5H2,1-2H3,(H,19,20)
InChIKeyOLIKUEPTLOIGEJ-UHFFFAOYSA-N
XLogP2.70
TPSA100.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.32
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid?
The IUPAC name of 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid (CID 119179176) is 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid.
What is the SMILES notation for 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid?
The canonical SMILES for 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid is CC1CCCC(C)N1C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1.
What is the InChIKey of 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid?
The InChIKey is OLIKUEPTLOIGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-9-4-3-5-10(2)16(9)14(18)11-6-12(15(19)20)8-13(7-11)17(21)22/h6-10H,3-5H2,1-2H3,(H,19,20).
What are the key properties of 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid?
3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid has a molecular weight of 306.32 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylpiperidine-1-carbonyl)-5-nitrobenzoic acid is sourced from PubChem (CID 119179176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).