C15H18N2O6 — CID 119184809
3-[3-(methoxymethyl)piperidine-1-carbonyl]-5-nitrobenzoic acid (PubChem CID 119184809) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 3-[3-(methoxymethyl)piperidine-1-carbonyl]-5-nitrobenzoic acid.
| Compound Name | 3-[3-(methoxymethyl)piperidine-1-carbonyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 119184809 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[3-(methoxymethyl)piperidine-1-carbonyl]-5-nitrobenzoic acid |
| SMILES | COCC1CCCN(C(=O)c2cc(C(=O)O)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H18N2O6/c1-23-9-10-3-2-4-16(8-10)14(18)11-5-12(15(19)20)7-13(6-11)17(21)22/h5-7,10H,2-4,8-9H2,1H3,(H,19,20) |
| InChIKey | WMLXEZYQGGDRHR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|