C13H15N3O7S — CID 155962765
3-nitro-5-(3-sulfamoylpiperidine-1-carbonyl)benzoic acid (PubChem CID 155962765) has the molecular formula C13H15N3O7S and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-nitro-5-(3-sulfamoylpiperidine-1-carbonyl)benzoic acid.
| Compound Name | 3-nitro-5-(3-sulfamoylpiperidine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 155962765 |
| Molecular Formula | C13H15N3O7S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-nitro-5-(3-sulfamoylpiperidine-1-carbonyl)benzoic acid |
| SMILES | NS(=O)(=O)C1CCCN(C(=O)c2cc(C(=O)O)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C13H15N3O7S/c14-24(22,23)11-2-1-3-15(7-11)12(17)8-4-9(13(18)19)6-10(5-8)16(20)21/h4-6,11H,1-3,7H2,(H,18,19)(H2,14,22,23) |
| InChIKey | MNKDICLQXQLMLJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|