C14H18N2O4S — CID 63744549
1-(1,3-dihydro-2-benzofuran-5-carbonyl)piperidine-3-sulfonamide (PubChem CID 63744549) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-carbonyl)piperidine-3-sulfonamide.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 63744549 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-carbonyl)piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(C(=O)c2ccc3c(c2)COC3)C1 |
| InChI | InChI=1S/C14H18N2O4S/c15-21(18,19)13-2-1-5-16(7-13)14(17)10-3-4-11-8-20-9-12(11)6-10/h3-4,6,13H,1-2,5,7-9H2,(H2,15,18,19) |
| InChIKey | ITYASTLCXMJQSN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |