C18H23N3O6 — CID 119183245
3-[3-[(2-methylpropanoylamino)methyl]piperidine-1-carbonyl]-5-nitrobenzoic acid (PubChem CID 119183245) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-[3-[(2-methylpropanoylamino)methyl]piperidine-1-carbonyl]-5-nitrobenzoic acid.
| Compound Name | 3-[3-[(2-methylpropanoylamino)methyl]piperidine-1-carbonyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 119183245 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[3-[(2-methylpropanoylamino)methyl]piperidine-1-carbonyl]-5-nitrobenzoic acid |
| SMILES | CC(C)C(=O)NCC1CCCN(C(=O)c2cc(C(=O)O)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H23N3O6/c1-11(2)16(22)19-9-12-4-3-5-20(10-12)17(23)13-6-14(18(24)25)8-15(7-13)21(26)27/h6-8,11-12H,3-5,9-10H2,1-2H3,(H,19,22)(H,24,25) |
| InChIKey | NCJMXVCUKXKZSS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|