C19H28N2O5S2 — CID 88530602
[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-(methoxymethoxy)-5-methyl-2-nitrophenyl]methanone (PubChem CID 88530602) has the molecular formula C19H28N2O5S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-(methoxymethoxy)-5-methyl-2-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-(methoxymethoxy)-5-methyl-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 88530602 |
| Molecular Formula | C19H28N2O5S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-(methoxymethoxy)-5-methyl-2-nitrophenyl]methanone |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(C)c(OCOC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N2O5S2/c1-5-27-19(28-6-2)15-8-7-9-20(15)18(22)14-10-13(3)17(26-12-25-4)11-16(14)21(23)24/h10-11,15,19H,5-9,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | AXVCKSFSFXEIAY-HNNXBMFYSA-N |
| XLogP | 4.32 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|