C24H37BrN2O6S — CID 77259395
[4-(7-bromoheptoxy)-5-methoxy-2-nitrophenyl]-[2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 77259395) has the molecular formula C24H37BrN2O6S and a molecular weight of 561.54 g/mol. Its IUPAC name is [4-(7-bromoheptoxy)-5-methoxy-2-nitrophenyl]-[2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-(7-bromoheptoxy)-5-methoxy-2-nitrophenyl]-[2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 77259395 |
| Molecular Formula | C24H37BrN2O6S |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [4-(7-bromoheptoxy)-5-methoxy-2-nitrophenyl]-[2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCOC(SCC)C1CCCN1C(=O)c1cc(OC)c(OCCCCCCCBr)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H37BrN2O6S/c1-4-32-24(34-5-2)19-12-11-14-26(19)23(28)18-16-21(31-3)22(17-20(18)27(29)30)33-15-10-8-6-7-9-13-25/h16-17,19,24H,4-15H2,1-3H3 |
| InChIKey | HMPSKBPIHCMACH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|