C25H40N4O6S — CID 102244894
[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrophenyl]methanone (PubChem CID 102244894) has the molecular formula C25H40N4O6S and a molecular weight of 524.68 g/mol. Its IUPAC name is [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 102244894 |
| Molecular Formula | C25H40N4O6S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrophenyl]methanone |
| SMILES | CCOC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCCN2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H40N4O6S/c1-5-34-25(36-6-2)20-9-7-11-28(20)24(30)19-17-22(33-4)23(18-21(19)29(31)32)35-16-8-10-27-14-12-26(3)13-15-27/h17-18,20,25H,5-16H2,1-4H3/t20-,25?/m0/s1 |
| InChIKey | QCWLOLRCLUMINB-JINQPTGOSA-N |
| XLogP | 3.34 |
| TPSA | 97.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|