C19H27BrN2O6S — CID 67282754
[4-(2-bromoethoxy)-5-methoxy-2-nitrophenyl]-[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 67282754) has the molecular formula C19H27BrN2O6S and a molecular weight of 491.40 g/mol. Its IUPAC name is [4-(2-bromoethoxy)-5-methoxy-2-nitrophenyl]-[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-(2-bromoethoxy)-5-methoxy-2-nitrophenyl]-[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 67282754 |
| Molecular Formula | C19H27BrN2O6S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [4-(2-bromoethoxy)-5-methoxy-2-nitrophenyl]-[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCOC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCBr)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27BrN2O6S/c1-4-27-19(29-5-2)14-7-6-9-21(14)18(23)13-11-16(26-3)17(28-10-8-20)12-15(13)22(24)25/h11-12,14,19H,4-10H2,1-3H3/t14-,19?/m0/s1 |
| InChIKey | DDLJGRLMAMWYOP-KTQQKIMGSA-N |
| XLogP | 4.10 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|