C18H23BrN2O6 — CID 87591493
(2S)-1-[4-(5-bromopentoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde (PubChem CID 87591493) has the molecular formula C18H23BrN2O6 and a molecular weight of 443.29 g/mol. Its IUPAC name is (2S)-1-[4-(5-bromopentoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-[4-(5-bromopentoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 87591493 |
| Molecular Formula | C18H23BrN2O6 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (2S)-1-[4-(5-bromopentoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde |
| SMILES | COc1cc(C(=O)N2CCC[C@H]2C=O)c([N+](=O)[O-])cc1OCCCCCBr |
| InChI | InChI=1S/C18H23BrN2O6/c1-26-16-10-14(18(23)20-8-5-6-13(20)12-22)15(21(24)25)11-17(16)27-9-4-2-3-7-19/h10-13H,2-9H2,1H3/t13-/m0/s1 |
| InChIKey | QYWKONQTRDNPEG-ZDUSSCGKSA-N |
| XLogP | 3.35 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|