C31H25N3O7 — CID 87989223
2-[4-[(2S)-2-formylpyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]-N-pyren-1-ylacetamide (PubChem CID 87989223) has the molecular formula C31H25N3O7 and a molecular weight of 551.56 g/mol. Its IUPAC name is 2-[4-[(2S)-2-formylpyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]-N-pyren-1-ylacetamide.
| Compound Name | 2-[4-[(2S)-2-formylpyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]-N-pyren-1-ylacetamide |
|---|---|
| PubChem CID | 87989223 |
| Molecular Formula | C31H25N3O7 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-[4-[(2S)-2-formylpyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]-N-pyren-1-ylacetamide |
| SMILES | COc1cc(C(=O)N2CCC[C@H]2C=O)c([N+](=O)[O-])cc1OCC(=O)Nc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C31H25N3O7/c1-40-26-14-23(31(37)33-13-3-6-21(33)16-35)25(34(38)39)15-27(26)41-17-28(36)32-24-12-10-20-8-7-18-4-2-5-19-9-11-22(24)30(20)29(18)19/h2,4-5,7-12,14-16,21H,3,6,13,17H2,1H3,(H,32,36)/t21-/m0/s1 |
| InChIKey | URQZHRBWZUGFNL-NRFANRHFSA-N |
| XLogP | 5.32 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|