C19H26N2O8 — CID 156578607
methyl 4-[4-[2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoate (PubChem CID 156578607) has the molecular formula C19H26N2O8 and a molecular weight of 410.42 g/mol. Its IUPAC name is methyl 4-[4-[2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoate.
| Compound Name | methyl 4-[4-[2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoate |
|---|---|
| PubChem CID | 156578607 |
| Molecular Formula | C19H26N2O8 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | methyl 4-[4-[2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cc([N+](=O)[O-])c(C(=O)N2CCCCC2CO)cc1OC |
| InChI | InChI=1S/C19H26N2O8/c1-27-16-10-14(19(24)20-8-4-3-6-13(20)12-22)15(21(25)26)11-17(16)29-9-5-7-18(23)28-2/h10-11,13,22H,3-9,12H2,1-2H3 |
| InChIKey | OFUJPJPRLUOULI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|