C22H32N2O8 — CID 156578587
methyl 4-[5-(ethoxycarbonylamino)-4-[(2S)-2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxyphenoxy]butanoate (PubChem CID 156578587) has the molecular formula C22H32N2O8 and a molecular weight of 452.50 g/mol. Its IUPAC name is methyl 4-[5-(ethoxycarbonylamino)-4-[(2S)-2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxyphenoxy]butanoate.
| Compound Name | methyl 4-[5-(ethoxycarbonylamino)-4-[(2S)-2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxyphenoxy]butanoate |
|---|---|
| PubChem CID | 156578587 |
| Molecular Formula | C22H32N2O8 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | methyl 4-[5-(ethoxycarbonylamino)-4-[(2S)-2-(hydroxymethyl)piperidine-1-carbonyl]-2-methoxyphenoxy]butanoate |
| SMILES | CCOC(=O)Nc1cc(OCCCC(=O)OC)c(OC)cc1C(=O)N1CCCC[C@H]1CO |
| InChI | InChI=1S/C22H32N2O8/c1-4-31-22(28)23-17-13-19(32-11-7-9-20(26)30-3)18(29-2)12-16(17)21(27)24-10-6-5-8-15(24)14-25/h12-13,15,25H,4-11,14H2,1-3H3,(H,23,28)/t15-/m0/s1 |
| InChIKey | FSNPGBYPSMHGSV-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|