C31H45N3O6S2 — CID 154621478
2-(pyridin-2-yldisulfanyl)propyl N-[5-(6,6-dimethylheptoxy)-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate (PubChem CID 154621478) has the molecular formula C31H45N3O6S2 and a molecular weight of 619.85 g/mol. Its IUPAC name is 2-(pyridin-2-yldisulfanyl)propyl N-[5-(6,6-dimethylheptoxy)-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate.
| Compound Name | 2-(pyridin-2-yldisulfanyl)propyl N-[5-(6,6-dimethylheptoxy)-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 154621478 |
| Molecular Formula | C31H45N3O6S2 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 2-(pyridin-2-yldisulfanyl)propyl N-[5-(6,6-dimethylheptoxy)-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate |
| SMILES | COc1cc(C(=O)N2CCC[C@H]2CO)c(NC(=O)OCC(C)SSc2ccccn2)cc1OCCCCCC(C)(C)C |
| InChI | InChI=1S/C31H45N3O6S2/c1-22(41-42-28-13-7-9-15-32-28)21-40-30(37)33-25-19-27(39-17-10-6-8-14-31(2,3)4)26(38-5)18-24(25)29(36)34-16-11-12-23(34)20-35/h7,9,13,15,18-19,22-23,35H,6,8,10-12,14,16-17,20-21H2,1-5H3,(H,33,37)/t22?,23-/m0/s1 |
| InChIKey | HJUWXUMPRHXHSD-WCSIJFPASA-N |
| XLogP | 7.05 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|