C17H22N2O6 — CID 11002603
prop-2-enyl N-[5-hydroxy-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate (PubChem CID 11002603) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is prop-2-enyl N-[5-hydroxy-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate.
| Compound Name | prop-2-enyl N-[5-hydroxy-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 11002603 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | prop-2-enyl N-[5-hydroxy-2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]-4-methoxyphenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1cc(O)c(OC)cc1C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C17H22N2O6/c1-3-7-25-17(23)18-13-9-14(21)15(24-2)8-12(13)16(22)19-6-4-5-11(19)10-20/h3,8-9,11,20-21H,1,4-7,10H2,2H3,(H,18,23)/t11-/m0/s1 |
| InChIKey | NVRCCQLFQJDOHH-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|