C23H30N2O8 — CID 145325720
methyl 4-[4-[(2S)-2-(1-hydroxyethenyl)pyrrolidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]butanoate (PubChem CID 145325720) has the molecular formula C23H30N2O8 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl 4-[4-[(2S)-2-(1-hydroxyethenyl)pyrrolidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]butanoate.
| Compound Name | methyl 4-[4-[(2S)-2-(1-hydroxyethenyl)pyrrolidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]butanoate |
|---|---|
| PubChem CID | 145325720 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | methyl 4-[4-[(2S)-2-(1-hydroxyethenyl)pyrrolidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]butanoate |
| SMILES | C=CCOC(=O)Nc1cc(OCCCC(=O)OC)c(OC)cc1C(=O)N1CCC[C@H]1C(=C)O |
| InChI | InChI=1S/C23H30N2O8/c1-5-11-33-23(29)24-17-14-20(32-12-7-9-21(27)31-4)19(30-3)13-16(17)22(28)25-10-6-8-18(25)15(2)26/h5,13-14,18,26H,1-2,6-12H2,3-4H3,(H,24,29)/t18-/m0/s1 |
| InChIKey | XWKVEFPAWKMZHC-SFHVURJKSA-N |
| XLogP | 3.44 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|