C17H22BrNO6 — CID 131977445
4-(5-bromopentoxy)-5-methoxy-2-(prop-2-enoxycarbonylamino)benzoic acid (PubChem CID 131977445) has the molecular formula C17H22BrNO6 and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-(5-bromopentoxy)-5-methoxy-2-(prop-2-enoxycarbonylamino)benzoic acid.
| Compound Name | 4-(5-bromopentoxy)-5-methoxy-2-(prop-2-enoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 131977445 |
| Molecular Formula | C17H22BrNO6 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 4-(5-bromopentoxy)-5-methoxy-2-(prop-2-enoxycarbonylamino)benzoic acid |
| SMILES | C=CCOC(=O)Nc1cc(OCCCCCBr)c(OC)cc1C(=O)O |
| InChI | InChI=1S/C17H22BrNO6/c1-3-8-25-17(22)19-13-11-15(24-9-6-4-5-7-18)14(23-2)10-12(13)16(20)21/h3,10-11H,1,4-9H2,2H3,(H,19,22)(H,20,21) |
| InChIKey | IGRYYIPDVDEVFP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|