C24H35N3O7 — CID 145400077
6-[4-[(2S)-2-(aminomethyl)piperidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]hexanoic acid (PubChem CID 145400077) has the molecular formula C24H35N3O7 and a molecular weight of 477.56 g/mol. Its IUPAC name is 6-[4-[(2S)-2-(aminomethyl)piperidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]hexanoic acid.
| Compound Name | 6-[4-[(2S)-2-(aminomethyl)piperidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145400077 |
| Molecular Formula | C24H35N3O7 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 6-[4-[(2S)-2-(aminomethyl)piperidine-1-carbonyl]-2-methoxy-5-(prop-2-enoxycarbonylamino)phenoxy]hexanoic acid |
| SMILES | C=CCOC(=O)Nc1cc(OCCCCCC(=O)O)c(OC)cc1C(=O)N1CCCC[C@H]1CN |
| InChI | InChI=1S/C24H35N3O7/c1-3-12-34-24(31)26-19-15-21(33-13-8-4-5-10-22(28)29)20(32-2)14-18(19)23(30)27-11-7-6-9-17(27)16-25/h3,14-15,17H,1,4-13,16,25H2,2H3,(H,26,31)(H,28,29)/t17-/m0/s1 |
| InChIKey | WVBVDEDGTDDYEE-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|