C23H36N2O5S2 — CID 101111489
methyl 5-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentanoate (PubChem CID 101111489) has the molecular formula C23H36N2O5S2 and a molecular weight of 484.68 g/mol. Its IUPAC name is methyl 5-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentanoate.
| Compound Name | methyl 5-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentanoate |
|---|---|
| PubChem CID | 101111489 |
| Molecular Formula | C23H36N2O5S2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 5-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentanoate |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCCCC(=O)OC)cc1N |
| InChI | InChI=1S/C23H36N2O5S2/c1-5-31-23(32-6-2)18-10-9-12-25(18)22(27)16-14-19(28-3)20(15-17(16)24)30-13-8-7-11-21(26)29-4/h14-15,18,23H,5-13,24H2,1-4H3/t18-/m0/s1 |
| InChIKey | KXWPWVGJWABPCT-SFHVURJKSA-N |
| XLogP | 4.44 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|