C27H38N2O4S2 — CID 10815788
[2-amino-5-methoxy-4-(3-phenylmethoxypropoxy)phenyl]-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 10815788) has the molecular formula C27H38N2O4S2 and a molecular weight of 518.75 g/mol. Its IUPAC name is [2-amino-5-methoxy-4-(3-phenylmethoxypropoxy)phenyl]-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | [2-amino-5-methoxy-4-(3-phenylmethoxypropoxy)phenyl]-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 10815788 |
| Molecular Formula | C27H38N2O4S2 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [2-amino-5-methoxy-4-(3-phenylmethoxypropoxy)phenyl]-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCCOCc2ccccc2)cc1N |
| InChI | InChI=1S/C27H38N2O4S2/c1-4-34-27(35-5-2)23-13-9-14-29(23)26(30)21-17-24(31-3)25(18-22(21)28)33-16-10-15-32-19-20-11-7-6-8-12-20/h6-8,11-12,17-18,23,27H,4-5,9-10,13-16,19,28H2,1-3H3/t23-/m0/s1 |
| InChIKey | WPEIDQVYICUZDE-QHCPKHFHSA-N |
| XLogP | 5.70 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|