C24H30N4O3S2 — CID 102188187
(2-azido-5-methoxy-4-phenylmethoxyphenyl)-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 102188187) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (2-azido-5-methoxy-4-phenylmethoxyphenyl)-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | (2-azido-5-methoxy-4-phenylmethoxyphenyl)-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 102188187 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2-azido-5-methoxy-4-phenylmethoxyphenyl)-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCc2ccccc2)cc1N=[N+]=[N-] |
| InChI | InChI=1S/C24H30N4O3S2/c1-4-32-24(33-5-2)20-12-9-13-28(20)23(29)18-14-21(30-3)22(15-19(18)26-27-25)31-16-17-10-7-6-8-11-17/h6-8,10-11,14-15,20,24H,4-5,9,12-13,16H2,1-3H3/t20-/m0/s1 |
| InChIKey | DTFICQIMFMKJOX-FQEVSTJZSA-N |
| XLogP | 6.65 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|