C21H30N2O7S2 — CID 10505106
4-[4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoic acid (PubChem CID 10505106) has the molecular formula C21H30N2O7S2 and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoic acid.
| Compound Name | 4-[4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
|---|---|
| PubChem CID | 10505106 |
| Molecular Formula | C21H30N2O7S2 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCCC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30N2O7S2/c1-4-31-21(32-5-2)15-8-6-10-22(15)20(26)14-12-17(29-3)18(13-16(14)23(27)28)30-11-7-9-19(24)25/h12-13,15,21H,4-11H2,1-3H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | OYYYDGMQNXBYMP-HNNXBMFYSA-N |
| XLogP | 4.28 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|