C20H28BrFN2O5S2 — CID 45258524
[(2S)-2-[bis(ethylsulfanyl)methyl]-4-fluoropyrrolidin-1-yl]-[4-(3-bromopropoxy)-5-methoxy-2-nitrophenyl]methanone (PubChem CID 45258524) has the molecular formula C20H28BrFN2O5S2 and a molecular weight of 539.49 g/mol. Its IUPAC name is [(2S)-2-[bis(ethylsulfanyl)methyl]-4-fluoropyrrolidin-1-yl]-[4-(3-bromopropoxy)-5-methoxy-2-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[bis(ethylsulfanyl)methyl]-4-fluoropyrrolidin-1-yl]-[4-(3-bromopropoxy)-5-methoxy-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 45258524 |
| Molecular Formula | C20H28BrFN2O5S2 |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | [(2S)-2-[bis(ethylsulfanyl)methyl]-4-fluoropyrrolidin-1-yl]-[4-(3-bromopropoxy)-5-methoxy-2-nitrophenyl]methanone |
| SMILES | CCSC(SCC)[C@@H]1CC(F)CN1C(=O)c1cc(OC)c(OCCCBr)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28BrFN2O5S2/c1-4-30-20(31-5-2)16-9-13(22)12-23(16)19(25)14-10-17(28-3)18(29-8-6-7-21)11-15(14)24(26)27/h10-11,13,16,20H,4-9,12H2,1-3H3/t13?,16-/m0/s1 |
| InChIKey | GTVOYKAMRDHZCQ-VYIIXAMBSA-N |
| XLogP | 5.15 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|