C21H28F2N2O5S2 — CID 88999603
5-[(2S)-2-[bis(ethylsulfanyl)methyl]-4,4-difluoropyrrolidine-1-carbonyl]-2-butoxy-4-nitrobenzaldehyde (PubChem CID 88999603) has the molecular formula C21H28F2N2O5S2 and a molecular weight of 490.59 g/mol. Its IUPAC name is 5-[(2S)-2-[bis(ethylsulfanyl)methyl]-4,4-difluoropyrrolidine-1-carbonyl]-2-butoxy-4-nitrobenzaldehyde.
| Compound Name | 5-[(2S)-2-[bis(ethylsulfanyl)methyl]-4,4-difluoropyrrolidine-1-carbonyl]-2-butoxy-4-nitrobenzaldehyde |
|---|---|
| PubChem CID | 88999603 |
| Molecular Formula | C21H28F2N2O5S2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-[(2S)-2-[bis(ethylsulfanyl)methyl]-4,4-difluoropyrrolidine-1-carbonyl]-2-butoxy-4-nitrobenzaldehyde |
| SMILES | CCCCOc1cc([N+](=O)[O-])c(C(=O)N2CC(F)(F)C[C@H]2C(SCC)SCC)cc1C=O |
| InChI | InChI=1S/C21H28F2N2O5S2/c1-4-7-8-30-18-10-16(25(28)29)15(9-14(18)12-26)19(27)24-13-21(22,23)11-17(24)20(31-5-2)32-6-3/h9-10,12,17,20H,4-8,11,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | QUMHOKRXZBSCCL-KRWDZBQOSA-N |
| XLogP | 5.27 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|