C31H41N3O14 — CID 159026122
4-butoxy-5-methoxy-2-nitrobenzoic acid;methyl (2S,4S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-4-hydroxypiperidine-2-carboxylate (PubChem CID 159026122) has the molecular formula C31H41N3O14 and a molecular weight of 679.68 g/mol. Its IUPAC name is 4-butoxy-5-methoxy-2-nitrobenzoic acid;methyl (2S,4S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-4-hydroxypiperidine-2-carboxylate.
| Compound Name | 4-butoxy-5-methoxy-2-nitrobenzoic acid;methyl (2S,4S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-4-hydroxypiperidine-2-carboxylate |
|---|---|
| PubChem CID | 159026122 |
| Molecular Formula | C31H41N3O14 |
| Molecular Weight | 679.68 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | 4-butoxy-5-methoxy-2-nitrobenzoic acid;methyl (2S,4S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-4-hydroxypiperidine-2-carboxylate |
| SMILES | CCCCOc1cc([N+](=O)[O-])c(C(=O)N2CC[C@H](O)C[C@H]2C(=O)OC)cc1OC.CCCCOc1cc([N+](=O)[O-])c(C(=O)O)cc1OC |
| InChI | InChI=1S/C19H26N2O8.C12H15NO6/c1-4-5-8-29-17-11-14(21(25)26)13(10-16(17)27-2)18(23)20-7-6-12(22)9-15(20)19(24)28-3;1-3-4-5-19-11-7-9(13(16)17)8(12(14)15)6-10(11)18-2/h10-12,15,22H,4-9H2,1-3H3;6-7H,3-5H2,1-2H3,(H,14,15)/t12-,15-;/m0./s1 |
| InChIKey | JUHMSMWVUXCQBG-NXCSSKFKSA-N |
| XLogP | 4.40 |
| TPSA | 227.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|