C23H26N2O8 — CID 121478566
methyl (3S)-2-(4-butoxy-5-methoxy-2-nitrobenzoyl)-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 121478566) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is methyl (3S)-2-(4-butoxy-5-methoxy-2-nitrobenzoyl)-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl (3S)-2-(4-butoxy-5-methoxy-2-nitrobenzoyl)-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 121478566 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl (3S)-2-(4-butoxy-5-methoxy-2-nitrobenzoyl)-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCCCOc1cc([N+](=O)[O-])c(C(=O)N2Cc3cc(O)ccc3C[C@H]2C(=O)OC)cc1OC |
| InChI | InChI=1S/C23H26N2O8/c1-4-5-8-33-21-12-18(25(29)30)17(11-20(21)31-2)22(27)24-13-15-9-16(26)7-6-14(15)10-19(24)23(28)32-3/h6-7,9,11-12,19,26H,4-5,8,10,13H2,1-3H3/t19-/m0/s1 |
| InChIKey | JYPLWLKQGRBALL-IBGZPJMESA-N |
| XLogP | 3.23 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|