C17H21BrN2O6 — CID 87981167
(2S)-1-[4-(3-bromobutoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde (PubChem CID 87981167) has the molecular formula C17H21BrN2O6 and a molecular weight of 429.27 g/mol. Its IUPAC name is (2S)-1-[4-(3-bromobutoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-[4-(3-bromobutoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 87981167 |
| Molecular Formula | C17H21BrN2O6 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (2S)-1-[4-(3-bromobutoxy)-5-methoxy-2-nitrobenzoyl]pyrrolidine-2-carbaldehyde |
| SMILES | COc1cc(C(=O)N2CCC[C@H]2C=O)c([N+](=O)[O-])cc1OCCC(C)Br |
| InChI | InChI=1S/C17H21BrN2O6/c1-11(18)5-7-26-16-9-14(20(23)24)13(8-15(16)25-2)17(22)19-6-3-4-12(19)10-21/h8-12H,3-7H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | CUJIPBGTQCXPMG-KIYNQFGBSA-N |
| XLogP | 2.96 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|