C20H32N2O6S3 — CID 101343062
2-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]ethyl methanesulfonate (PubChem CID 101343062) has the molecular formula C20H32N2O6S3 and a molecular weight of 492.69 g/mol. Its IUPAC name is 2-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]ethyl methanesulfonate.
| Compound Name | 2-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 101343062 |
| Molecular Formula | C20H32N2O6S3 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]ethyl methanesulfonate |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCOS(C)(=O)=O)cc1N |
| InChI | InChI=1S/C20H32N2O6S3/c1-5-29-20(30-6-2)16-8-7-9-22(16)19(23)14-12-17(26-3)18(13-15(14)21)27-10-11-28-31(4,24)25/h12-13,16,20H,5-11,21H2,1-4H3/t16-/m0/s1 |
| InChIKey | QMCLWYHLALJLFY-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|