C35H43N5O5S2 — CID 58584404
2-[[4-[[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]methyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 58584404) has the molecular formula C35H43N5O5S2 and a molecular weight of 677.89 g/mol. Its IUPAC name is 2-[[4-[[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]methyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[4-[[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]methyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 58584404 |
| Molecular Formula | C35H43N5O5S2 |
| Molecular Weight | 677.89 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | 2-[[4-[[5-amino-4-[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carbonyl]-2-methoxyphenoxy]methyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCN2CCN(CN3C(=O)c4cccc5cccc(c45)C3=O)CC2)cc1N |
| InChI | InChI=1S/C35H43N5O5S2/c1-4-46-35(47-5-2)28-13-8-14-39(28)34(43)26-19-29(44-3)30(20-27(26)36)45-22-38-17-15-37(16-18-38)21-40-32(41)24-11-6-9-23-10-7-12-25(31(23)24)33(40)42/h6-7,9-12,19-20,28,35H,4-5,8,13-18,21-22,36H2,1-3H3/t28-/m0/s1 |
| InChIKey | KQEHPYYCNAVNKC-NDEPHWFRSA-N |
| XLogP | 5.08 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|