C27H29N3O5 — CID 92945164
2-[[4-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 92945164) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[[4-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[4-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 92945164 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[[4-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]methyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | COc1cccc(OC[C@H](O)CN2CCN(CN3C(=O)c4cccc5cccc(c45)C3=O)CC2)c1 |
| InChI | InChI=1S/C27H29N3O5/c1-34-21-7-4-8-22(15-21)35-17-20(31)16-28-11-13-29(14-12-28)18-30-26(32)23-9-2-5-19-6-3-10-24(25(19)23)27(30)33/h2-10,15,20,31H,11-14,16-18H2,1H3/t20-/m1/s1 |
| InChIKey | LAJUQQDZGXLUPJ-HXUWFJFHSA-N |
| XLogP | 2.46 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|