C17H24N2O4S2 — CID 88556317
[(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-5-methoxy-2-nitrosophenyl)methanone (PubChem CID 88556317) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-5-methoxy-2-nitrosophenyl)methanone.
| Compound Name | [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-5-methoxy-2-nitrosophenyl)methanone |
|---|---|
| PubChem CID | 88556317 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2S)-2-[bis(ethylsulfanyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-5-methoxy-2-nitrosophenyl)methanone |
| SMILES | CCSC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(O)cc1N=O |
| InChI | InChI=1S/C17H24N2O4S2/c1-4-24-17(25-5-2)13-7-6-8-19(13)16(21)11-9-15(23-3)14(20)10-12(11)18-22/h9-10,13,17,20H,4-8H2,1-3H3/t13-/m0/s1 |
| InChIKey | GHTYTCMCVTVIBE-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|