C25H40N2O9Si — CID 140774933
methyl 4-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4,5-dimethoxy-2-nitrobenzoyl)pyrrolidin-3-yl]oxybutanoate (PubChem CID 140774933) has the molecular formula C25H40N2O9Si and a molecular weight of 540.69 g/mol. Its IUPAC name is methyl 4-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4,5-dimethoxy-2-nitrobenzoyl)pyrrolidin-3-yl]oxybutanoate.
| Compound Name | methyl 4-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4,5-dimethoxy-2-nitrobenzoyl)pyrrolidin-3-yl]oxybutanoate |
|---|---|
| PubChem CID | 140774933 |
| Molecular Formula | C25H40N2O9Si |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | methyl 4-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4,5-dimethoxy-2-nitrobenzoyl)pyrrolidin-3-yl]oxybutanoate |
| SMILES | COC(=O)CCCO[C@H]1CCN(C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40N2O9Si/c1-25(2,3)37(7,8)36-16-19-20(35-13-9-10-23(28)34-6)11-12-26(19)24(29)17-14-21(32-4)22(33-5)15-18(17)27(30)31/h14-15,19-20H,9-13,16H2,1-8H3/t19-,20+/m1/s1 |
| InChIKey | WIAXFRFIRZQNGD-UXHICEINSA-N |
| XLogP | 4.19 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|