C24H32N2O6Si — CID 140882285
[(3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-(4-hydroxy-5-methoxy-2-nitrophenyl)methanone (PubChem CID 140882285) has the molecular formula C24H32N2O6Si and a molecular weight of 472.61 g/mol. Its IUPAC name is [(3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-(4-hydroxy-5-methoxy-2-nitrophenyl)methanone.
| Compound Name | [(3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-(4-hydroxy-5-methoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 140882285 |
| Molecular Formula | C24H32N2O6Si |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [(3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-(4-hydroxy-5-methoxy-2-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2Cc3ccccc3C[C@H]2CO[Si](C)(C)C(C)(C)C)c([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C24H32N2O6Si/c1-24(2,3)33(5,6)32-15-18-11-16-9-7-8-10-17(16)14-25(18)23(28)19-12-22(31-4)21(27)13-20(19)26(29)30/h7-10,12-13,18,27H,11,14-15H2,1-6H3/t18-/m0/s1 |
| InChIKey | CVGZCFIRAQQOOT-SFHVURJKSA-N |
| XLogP | 4.90 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|