C25H37F3N2O9SSi — CID 156673663
[(2S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 156673663) has the molecular formula C25H37F3N2O9SSi and a molecular weight of 626.72 g/mol. Its IUPAC name is [(2S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [(2S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156673663 |
| Molecular Formula | C25H37F3N2O9SSi |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | [(2S)-1-(4-butoxy-5-methoxy-2-nitrobenzoyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | CCCCOc1cc([N+](=O)[O-])c(C(=O)N2CC=C(OS(=O)(=O)C(F)(F)F)C[C@H]2CO[Si](C)(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C25H37F3N2O9SSi/c1-8-9-12-37-22-15-20(30(32)33)19(14-21(22)36-5)23(31)29-11-10-18(39-40(34,35)25(26,27)28)13-17(29)16-38-41(6,7)24(2,3)4/h10,14-15,17H,8-9,11-13,16H2,1-7H3/t17-/m0/s1 |
| InChIKey | ODBJWFOZCXEENU-KRWDZBQOSA-N |
| XLogP | 5.77 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|